From b29e4283c36b57f57d84f5269f0844958e3c411c Mon Sep 17 00:00:00 2001 From: Lester Hedges Date: Wed, 4 Dec 2024 16:33:32 +0000 Subject: [PATCH] Backport tests from PR #373. [ci skip] --- tests/Convert/test_convert.py | 33 +++++++++++++++++++ .../Exscientia/Convert/test_convert.py | 33 +++++++++++++++++++ 2 files changed, 66 insertions(+) diff --git a/tests/Convert/test_convert.py b/tests/Convert/test_convert.py index 8823e4ef9..106f40753 100644 --- a/tests/Convert/test_convert.py +++ b/tests/Convert/test_convert.py @@ -86,3 +86,36 @@ def test_molecule_rename(): # Make sure the name is correct. assert mol._sire_object.name().value() == "smiles:[C@@H](C(F)(F)F)(OC(F)F)Cl" + + +@pytest.mark.parametrize("lig", ["2dd", "2hh", "2ii", "2s", "2x"]) +def test_sdf_stereo(lig): + """ + Test that SDF stereochemistry is correctly preserved when converting + to RDKit format via Sire. + """ + + import tempfile + + from rdkit import Chem + from tests.conftest import url + + # Load the molecule. + mol = BSS.IO.readMolecules(f"{url}/lig_{lig}.sdf")[0] + + with tempfile.NamedTemporaryFile() as f: + # Write the molecule to a temporary file. + BSS.IO.saveMolecules(f.name, mol, "sdf") + + # Load the molecule using RDKit. + rdmol = Chem.SDMolSupplier(f"{f.name}.sdf")[0] + + # Convert the molecule using Sire. + rdmol_sire = BSS.Convert.toRDKit(mol) + + # Get the SMILES strings. + smiles = Chem.CanonSmiles(Chem.MolToSmiles(rdmol)) + smiles_sire = Chem.CanonSmiles(Chem.MolToSmiles(rdmol_sire)) + + # Check that the SMILES strings are the same. + assert smiles == smiles_sire diff --git a/tests/Sandpit/Exscientia/Convert/test_convert.py b/tests/Sandpit/Exscientia/Convert/test_convert.py index e444c3144..7a4032024 100644 --- a/tests/Sandpit/Exscientia/Convert/test_convert.py +++ b/tests/Sandpit/Exscientia/Convert/test_convert.py @@ -94,3 +94,36 @@ def test_molecule_rename(): # Make sure the name is correct. assert mol._sire_object.name().value() == "smiles:[C@@H](C(F)(F)F)(OC(F)F)Cl" + + +@pytest.mark.parametrize("lig", ["2dd", "2hh", "2ii", "2s", "2x"]) +def test_sdf_stereo(lig): + """ + Test that SDF stereochemistry is correctly preserved when converting + to RDKit format via Sire. + """ + + import tempfile + + from rdkit import Chem + from tests.conftest import url + + # Load the molecule. + mol = BSS.IO.readMolecules(f"{url}/lig_{lig}.sdf")[0] + + with tempfile.NamedTemporaryFile() as f: + # Write the molecule to a temporary file. + BSS.IO.saveMolecules(f.name, mol, "sdf") + + # Load the molecule using RDKit. + rdmol = Chem.SDMolSupplier(f"{f.name}.sdf")[0] + + # Convert the molecule using Sire. + rdmol_sire = BSS.Convert.toRDKit(mol) + + # Get the SMILES strings. + smiles = Chem.CanonSmiles(Chem.MolToSmiles(rdmol)) + smiles_sire = Chem.CanonSmiles(Chem.MolToSmiles(rdmol_sire)) + + # Check that the SMILES strings are the same. + assert smiles == smiles_sire